C23H15F7OS — CID 139654327
3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene (PubChem CID 139654327) has the molecular formula C23H15F7OS and a molecular weight of 472.43 g/mol. Its IUPAC name is 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene.
| Compound Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 139654327 |
| Molecular Formula | C23H15F7OS |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophene |
| SMILES | COc1ccc(C=Cc2ccc3c(C4=C(F)C(F)(F)C(F)(F)C4(F)F)c(C)sc3c2)cc1 |
| InChI | InChI=1S/C23H15F7OS/c1-12-18(19-20(24)22(27,28)23(29,30)21(19,25)26)16-10-7-14(11-17(16)32-12)4-3-13-5-8-15(31-2)9-6-13/h3-11H,1-2H3 |
| InChIKey | LHXPVGPHWQVQAM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|