C34H27F6NO2S — CID 173355180
3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole (PubChem CID 173355180) has the molecular formula C34H27F6NO2S and a molecular weight of 627.65 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
|---|---|
| PubChem CID | 173355180 |
| Molecular Formula | C34H27F6NO2S |
| Molecular Weight | 627.65 g/mol |
| Exact Mass | 627.17 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[5-[2-(4-methoxyphenyl)ethenyl]-2-methyl-1-benzothiophen-3-yl]cyclopenten-1-yl]-5-methoxy-1,2-dimethylindole |
| SMILES | COc1ccc(C=Cc2ccc3sc(C)c(C4=C(c5c(C)n(C)c6ccc(OC)cc56)C(F)(F)C(F)(F)C4(F)F)c3c2)cc1 |
| InChI | InChI=1S/C34H27F6NO2S/c1-18-28(24-17-23(43-5)13-14-26(24)41(18)3)30-31(33(37,38)34(39,40)32(30,35)36)29-19(2)44-27-15-10-21(16-25(27)29)7-6-20-8-11-22(42-4)12-9-20/h6-17H,1-5H3 |
| InChIKey | NNUTUFQSVAYZGC-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 23.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.65 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|