C17H15NO3 — CID 134133463
6-[(Z)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 134133463) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 6-[(Z)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-[(Z)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134133463 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 6-[(Z)-2-(4-methoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(/C=C\c2ccc3c(c2)oc(=O)n3C)cc1 |
| InChI | InChI=1S/C17H15NO3/c1-18-15-10-7-13(11-16(15)21-17(18)19)4-3-12-5-8-14(20-2)9-6-12/h3-11H,1-2H3/b4-3- |
| InChIKey | GIEJQXJJQYHMSI-ARJAWSKDSA-N |
| XLogP | 3.31 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|