C18H17NO4 — CID 134149491
4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one (PubChem CID 134149491) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134149491 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-3-methyl-1,3-benzoxazol-2-one |
| SMILES | COc1cc(/C=C/c2cccc3oc(=O)n(C)c23)cc(OC)c1 |
| InChI | InChI=1S/C18H17NO4/c1-19-17-13(5-4-6-16(17)23-18(19)20)8-7-12-9-14(21-2)11-15(10-12)22-3/h4-11H,1-3H3/b8-7+ |
| InChIKey | VVAVLGWMRBFXKK-BQYQJAHWSA-N |
| XLogP | 3.32 |
| TPSA | 53.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|