C17H15NO3 — CID 178068647
3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzonitrile (PubChem CID 178068647) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzonitrile.
| Compound Name | 3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzonitrile |
|---|---|
| PubChem CID | 178068647 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]-2-hydroxybenzonitrile |
| SMILES | COc1cc(/C=C/c2cccc(C#N)c2O)cc(OC)c1 |
| InChI | InChI=1S/C17H15NO3/c1-20-15-8-12(9-16(10-15)21-2)6-7-13-4-3-5-14(11-18)17(13)19/h3-10,19H,1-2H3/b7-6+ |
| InChIKey | KNGHVDUQUIVUEJ-VOTSOKGWSA-N |
| XLogP | 3.45 |
| TPSA | 62.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|