C66H54O6 — CID 101271454
1-[3,5-bis[3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulen-1-yl]phenyl]-3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulene (PubChem CID 101271454) has the molecular formula C66H54O6 and a molecular weight of 943.15 g/mol. Its IUPAC name is 1-[3,5-bis[3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulen-1-yl]phenyl]-3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulene.
| Compound Name | 1-[3,5-bis[3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulen-1-yl]phenyl]-3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulene |
|---|---|
| PubChem CID | 101271454 |
| Molecular Formula | C66H54O6 |
| Molecular Weight | 943.15 g/mol |
| Exact Mass | 942.39 |
| IUPAC Name | 1-[3,5-bis[3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulen-1-yl]phenyl]-3-[(E)-2-(3,5-dimethoxyphenyl)ethenyl]azulene |
| SMILES | COc1cc(/C=C/c2cc(-c3cc(-c4cc(/C=C/c5cc(OC)cc(OC)c5)c5cccccc4-5)cc(-c4cc(/C=C/c5cc(OC)cc(OC)c5)c5cccccc4-5)c3)c3cccccc2-3)cc(OC)c1 |
| InChI | InChI=1S/C66H54O6/c1-67-52-28-43(29-53(40-52)68-2)22-25-46-37-64(61-19-13-7-10-16-58(46)61)49-34-50(65-38-47(59-17-11-8-14-20-62(59)65)26-23-44-30-54(69-3)41-55(31-44)70-4)36-51(35-49)66-39-48(60-18-12-9-15-21-63(60)66)27-24-45-32-56(71-5)42-57(33-45)72-6/h7-42H,1-6H3/b25-22+,26-23+,27-24+ |
| InChIKey | MLDVIWCZVKFKDL-NQXXUPRISA-N |
| XLogP | 16.56 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 943.15 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |