C19H19NO5 — CID 134142820
3-methyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3-benzoxazol-2-one (PubChem CID 134142820) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 3-methyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 134142820 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 3-methyl-4-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]-1,3-benzoxazol-2-one |
| SMILES | COc1cc(/C=C/c2cccc3oc(=O)n(C)c23)cc(OC)c1OC |
| InChI | InChI=1S/C19H19NO5/c1-20-17-13(6-5-7-14(17)25-19(20)21)9-8-12-10-15(22-2)18(24-4)16(11-12)23-3/h5-11H,1-4H3/b9-8+ |
| InChIKey | LTMRAOHJULKWRS-CMDGGOBGSA-N |
| XLogP | 3.33 |
| TPSA | 62.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|