C20H19NO6 — CID 54088296
3-methyl-6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-benzoxazol-2-one (PubChem CID 54088296) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is 3-methyl-6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 54088296 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-methyl-6-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-1,3-benzoxazol-2-one |
| SMILES | COc1cc(C=CC(=O)c2ccc3c(c2)oc(=O)n3C)cc(OC)c1OC |
| InChI | InChI=1S/C20H19NO6/c1-21-14-7-6-13(11-16(14)27-20(21)23)15(22)8-5-12-9-17(24-2)19(26-4)18(10-12)25-3/h5-11H,1-4H3 |
| InChIKey | MSAXBCRZYRPUDW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|