C28H27N3O4 — CID 24744903
3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one (PubChem CID 24744903) has the molecular formula C28H27N3O4 and a molecular weight of 469.54 g/mol. Its IUPAC name is 3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 24744903 |
| Molecular Formula | C28H27N3O4 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | 3-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one |
| SMILES | COc1ccccc1N1CCN(Cn2c(=O)oc3cc(C(=O)/C=C/c4ccccc4)ccc32)CC1 |
| InChI | InChI=1S/C28H27N3O4/c1-34-26-10-6-5-9-23(26)30-17-15-29(16-18-30)20-31-24-13-12-22(19-27(24)35-28(31)33)25(32)14-11-21-7-3-2-4-8-21/h2-14,19H,15-18,20H2,1H3/b14-11+ |
| InChIKey | WHMVFCRGXWVXNO-SDNWHVSQSA-N |
| XLogP | 4.28 |
| TPSA | 67.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|