C28H31N3O2 — CID 11826347
(E)-N-[[2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]-3-phenylprop-2-enamide (PubChem CID 11826347) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is (E)-N-[[2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 11826347 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | (E)-N-[[2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]phenyl]methyl]-3-phenylprop-2-enamide |
| SMILES | COc1ccccc1N1CCN(Cc2ccccc2CNC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C28H31N3O2/c1-33-27-14-8-7-13-26(27)31-19-17-30(18-20-31)22-25-12-6-5-11-24(25)21-29-28(32)16-15-23-9-3-2-4-10-23/h2-16H,17-22H2,1H3,(H,29,32)/b16-15+ |
| InChIKey | OUXSXBHPMQCPQT-FOCLMDBBSA-N |
| XLogP | 4.35 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|