C23H27F2N3O3 — CID 56517524
(E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide (PubChem CID 56517524) has the molecular formula C23H27F2N3O3 and a molecular weight of 431.48 g/mol. Its IUPAC name is (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 56517524 |
| Molecular Formula | C23H27F2N3O3 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | (E)-3-[4-(difluoromethoxy)-3-methoxyphenyl]-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCc2ccccc2N2CCN(C)CC2)ccc1OC(F)F |
| InChI | InChI=1S/C23H27F2N3O3/c1-27-11-13-28(14-12-27)19-6-4-3-5-18(19)16-26-22(29)10-8-17-7-9-20(31-23(24)25)21(15-17)30-2/h3-10,15,23H,11-14,16H2,1-2H3,(H,26,29)/b10-8+ |
| InChIKey | RJFUQPUXISXBPG-CSKARUKUSA-N |
| XLogP | 3.38 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|