C20H20N2O3 — CID 3062964
6-benzoyl-3-(piperidin-1-ylmethyl)-1,3-benzoxazol-2-one (PubChem CID 3062964) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is 6-benzoyl-3-(piperidin-1-ylmethyl)-1,3-benzoxazol-2-one.
| Compound Name | 6-benzoyl-3-(piperidin-1-ylmethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 3062964 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 6-benzoyl-3-(piperidin-1-ylmethyl)-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1)oc(=O)n2CN1CCCCC1 |
| InChI | InChI=1S/C20H20N2O3/c23-19(15-7-3-1-4-8-15)16-9-10-17-18(13-16)25-20(24)22(17)14-21-11-5-2-6-12-21/h1,3-4,7-10,13H,2,5-6,11-12,14H2 |
| InChIKey | POOSUWLKRAWFKU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |