C21H20N2O4 — CID 24744902
3-(morpholin-4-ylmethyl)-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one (PubChem CID 24744902) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 3-(morpholin-4-ylmethyl)-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-(morpholin-4-ylmethyl)-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 24744902 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 3-(morpholin-4-ylmethyl)-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc2c(c1)oc(=O)n2CN1CCOCC1 |
| InChI | InChI=1S/C21H20N2O4/c24-19(9-6-16-4-2-1-3-5-16)17-7-8-18-20(14-17)27-21(25)23(18)15-22-10-12-26-13-11-22/h1-9,14H,10-13,15H2/b9-6+ |
| InChIKey | AZCCVSYVUHAOTJ-RMKNXTFCSA-N |
| XLogP | 2.78 |
| TPSA | 64.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|