C19H18N2O3 — CID 24745064
3-[(dimethylamino)methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one (PubChem CID 24745064) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 3-[(dimethylamino)methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(dimethylamino)methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 24745064 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[(dimethylamino)methyl]-6-[(E)-3-phenylprop-2-enoyl]-1,3-benzoxazol-2-one |
| SMILES | CN(C)Cn1c(=O)oc2cc(C(=O)/C=C/c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H18N2O3/c1-20(2)13-21-16-10-9-15(12-18(16)24-19(21)23)17(22)11-8-14-6-4-3-5-7-14/h3-12H,13H2,1-2H3/b11-8+ |
| InChIKey | LULWPMRHGJPILP-DHZHZOJOSA-N |
| XLogP | 3.01 |
| TPSA | 55.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|