C25H21ClN4O5 — CID 10323416
6-(2-chlorobenzoyl)-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-benzoxazol-2-one (PubChem CID 10323416) has the molecular formula C25H21ClN4O5 and a molecular weight of 492.92 g/mol. Its IUPAC name is 6-(2-chlorobenzoyl)-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-benzoxazol-2-one.
| Compound Name | 6-(2-chlorobenzoyl)-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 10323416 |
| Molecular Formula | C25H21ClN4O5 |
| Molecular Weight | 492.92 g/mol |
| Exact Mass | 492.12 |
| IUPAC Name | 6-(2-chlorobenzoyl)-3-[[4-(4-nitrophenyl)piperazin-1-yl]methyl]-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2c(c1)oc(=O)n2CN1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccccc1Cl |
| InChI | InChI=1S/C25H21ClN4O5/c26-21-4-2-1-3-20(21)24(31)17-5-10-22-23(15-17)35-25(32)29(22)16-27-11-13-28(14-12-27)18-6-8-19(9-7-18)30(33)34/h1-10,15H,11-14,16H2 |
| InChIKey | HLNMYCFXSGOAKB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 101.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.92 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|