C23H16N2O7 — CID 10071443
6-(4-methoxybenzoyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-benzoxazol-2-one (PubChem CID 10071443) has the molecular formula C23H16N2O7 and a molecular weight of 432.39 g/mol. Its IUPAC name is 6-(4-methoxybenzoyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-benzoxazol-2-one.
| Compound Name | 6-(4-methoxybenzoyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 10071443 |
| Molecular Formula | C23H16N2O7 |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | 6-(4-methoxybenzoyl)-3-[2-(4-nitrophenyl)-2-oxoethyl]-1,3-benzoxazol-2-one |
| SMILES | COc1ccc(C(=O)c2ccc3c(c2)oc(=O)n3CC(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C23H16N2O7/c1-31-18-9-4-15(5-10-18)22(27)16-6-11-19-21(12-16)32-23(28)24(19)13-20(26)14-2-7-17(8-3-14)25(29)30/h2-12H,13H2,1H3 |
| InChIKey | FBRHVLFYGRVNQT-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 121.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|