C18H17N3O8S — CID 19259684
3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-N,N-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide (PubChem CID 19259684) has the molecular formula C18H17N3O8S and a molecular weight of 435.41 g/mol. Its IUPAC name is 3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-N,N-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide.
| Compound Name | 3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-N,N-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 19259684 |
| Molecular Formula | C18H17N3O8S |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 3-[2-(4-methoxy-3-nitrophenyl)-2-oxoethyl]-N,N-dimethyl-2-oxo-1,3-benzoxazole-6-sulfonamide |
| SMILES | COc1ccc(C(=O)Cn2c(=O)oc3cc(S(=O)(=O)N(C)C)ccc32)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17N3O8S/c1-19(2)30(26,27)12-5-6-13-17(9-12)29-18(23)20(13)10-15(22)11-4-7-16(28-3)14(8-11)21(24)25/h4-9H,10H2,1-3H3 |
| InChIKey | AQTMLGAOMQCVGA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 141.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|