C18H23N3O7 — CID 8951798
[(2S)-1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 8951798) has the molecular formula C18H23N3O7 and a molecular weight of 393.40 g/mol. Its IUPAC name is [(2S)-1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [(2S)-1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 8951798 |
| Molecular Formula | C18H23N3O7 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.15 |
| IUPAC Name | [(2S)-1-[di(propan-2-yl)amino]-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | CC(C)N(C(=O)[C@H](C)OC(=O)Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)C(C)C |
| InChI | InChI=1S/C18H23N3O7/c1-10(2)20(11(3)4)17(23)12(5)27-16(22)9-19-14-7-6-13(21(25)26)8-15(14)28-18(19)24/h6-8,10-12H,9H2,1-5H3/t12-/m0/s1 |
| InChIKey | WTZAHOYLVQIQAV-LBPRGKRZSA-N |
| XLogP | 2.08 |
| TPSA | 124.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|