C16H19N3O7 — CID 8951777
[(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 8951777) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 8951777 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | [(2S)-1-(tert-butylamino)-1-oxopropan-2-yl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | C[C@H](OC(=O)Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H19N3O7/c1-9(14(21)17-16(2,3)4)25-13(20)8-18-11-6-5-10(19(23)24)7-12(11)26-15(18)22/h5-7,9H,8H2,1-4H3,(H,17,21)/t9-/m0/s1 |
| InChIKey | VVGRYQORRHMWBX-VIFPVBQESA-N |
| XLogP | 1.35 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|