C15H7Cl3N2O6 — CID 55374488
(2,4,6-trichlorophenyl) 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 55374488) has the molecular formula C15H7Cl3N2O6 and a molecular weight of 417.59 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | (2,4,6-trichlorophenyl) 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 55374488 |
| Molecular Formula | C15H7Cl3N2O6 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 415.94 |
| IUPAC Name | (2,4,6-trichlorophenyl) 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)Oc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C15H7Cl3N2O6/c16-7-3-9(17)14(10(18)4-7)26-13(21)6-19-11-2-1-8(20(23)24)5-12(11)25-15(19)22/h1-5H,6H2 |
| InChIKey | JIPRZXOOLRUIAA-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 104.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|