C21H20N2O7 — CID 55367655
[2-(2,5-diethylphenyl)-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 55367655) has the molecular formula C21H20N2O7 and a molecular weight of 412.40 g/mol. Its IUPAC name is [2-(2,5-diethylphenyl)-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 55367655 |
| Molecular Formula | C21H20N2O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [2-(2,5-diethylphenyl)-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | CCc1ccc(CC)c(C(=O)COC(=O)Cn2c(=O)oc3cc([N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C21H20N2O7/c1-3-13-5-6-14(4-2)16(9-13)18(24)12-29-20(25)11-22-17-8-7-15(23(27)28)10-19(17)30-21(22)26/h5-10H,3-4,11-12H2,1-2H3 |
| InChIKey | MQDFXDJCNKPDBN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 121.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|