C18H13F2N3O7S — CID 55476171
[2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 55476171) has the molecular formula C18H13F2N3O7S and a molecular weight of 453.38 g/mol. Its IUPAC name is [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate.
| Compound Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
|---|---|
| PubChem CID | 55476171 |
| Molecular Formula | C18H13F2N3O7S |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 453.04 |
| IUPAC Name | [2-[2-(difluoromethylsulfanyl)anilino]-2-oxoethyl] 2-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c(=O)oc2cc([N+](=O)[O-])ccc21)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C18H13F2N3O7S/c19-17(20)31-14-4-2-1-3-11(14)21-15(24)9-29-16(25)8-22-12-6-5-10(23(27)28)7-13(12)30-18(22)26/h1-7,17H,8-9H2,(H,21,24) |
| InChIKey | LCRIYAZSWSTJNW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|