C20H19Cl2N3O5 — CID 46598838
N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide (PubChem CID 46598838) has the molecular formula C20H19Cl2N3O5 and a molecular weight of 452.29 g/mol. Its IUPAC name is N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide.
| Compound Name | N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
|---|---|
| PubChem CID | 46598838 |
| Molecular Formula | C20H19Cl2N3O5 |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[1-(2,4-dichlorophenyl)ethyl]-N-methyl-4-(6-nitro-2-oxo-1,3-benzoxazol-3-yl)butanamide |
| SMILES | CC(c1ccc(Cl)cc1Cl)N(C)C(=O)CCCn1c(=O)oc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C20H19Cl2N3O5/c1-12(15-7-5-13(21)10-16(15)22)23(2)19(26)4-3-9-24-17-8-6-14(25(28)29)11-18(17)30-20(24)27/h5-8,10-12H,3-4,9H2,1-2H3 |
| InChIKey | IIGJZXXTMFEWIR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 98.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|