C24H26N2O4 — CID 6224472
(E)-1-(3,4-dimethoxyphenyl)-3-[1-(morpholin-4-ylmethyl)indol-3-yl]prop-2-en-1-one (PubChem CID 6224472) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-[1-(morpholin-4-ylmethyl)indol-3-yl]prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-[1-(morpholin-4-ylmethyl)indol-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6224472 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-[1-(morpholin-4-ylmethyl)indol-3-yl]prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2cn(CN3CCOCC3)c3ccccc23)cc1OC |
| InChI | InChI=1S/C24H26N2O4/c1-28-23-10-8-18(15-24(23)29-2)22(27)9-7-19-16-26(17-25-11-13-30-14-12-25)21-6-4-3-5-20(19)21/h3-10,15-16H,11-14,17H2,1-2H3/b9-7+ |
| InChIKey | RVOCPZKJAPKNGE-VQHVLOKHSA-N |
| XLogP | 3.84 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|