C24H21NO3 — CID 71490478
(E)-1-(3,4-dimethoxyphenyl)-3-(9-methylcarbazol-3-yl)prop-2-en-1-one (PubChem CID 71490478) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (E)-1-(3,4-dimethoxyphenyl)-3-(9-methylcarbazol-3-yl)prop-2-en-1-one.
| Compound Name | (E)-1-(3,4-dimethoxyphenyl)-3-(9-methylcarbazol-3-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 71490478 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (E)-1-(3,4-dimethoxyphenyl)-3-(9-methylcarbazol-3-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc3c(c2)c2ccccc2n3C)cc1OC |
| InChI | InChI=1S/C24H21NO3/c1-25-20-7-5-4-6-18(20)19-14-16(8-11-21(19)25)9-12-22(26)17-10-13-23(27-2)24(15-17)28-3/h4-15H,1-3H3/b12-9+ |
| InChIKey | ZVWSYXPHBPSLCJ-FMIVXFBMSA-N |
| XLogP | 5.24 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|