C29H21FN2O2 — CID 70684873
3-fluoro-N-[3-[(E)-3-(9-methylcarbazol-3-yl)prop-2-enoyl]phenyl]benzamide (PubChem CID 70684873) has the molecular formula C29H21FN2O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 3-fluoro-N-[3-[(E)-3-(9-methylcarbazol-3-yl)prop-2-enoyl]phenyl]benzamide.
| Compound Name | 3-fluoro-N-[3-[(E)-3-(9-methylcarbazol-3-yl)prop-2-enoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 70684873 |
| Molecular Formula | C29H21FN2O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-fluoro-N-[3-[(E)-3-(9-methylcarbazol-3-yl)prop-2-enoyl]phenyl]benzamide |
| SMILES | Cn1c2ccccc2c2cc(/C=C/C(=O)c3cccc(NC(=O)c4cccc(F)c4)c3)ccc21 |
| InChI | InChI=1S/C29H21FN2O2/c1-32-26-11-3-2-10-24(26)25-16-19(12-14-27(25)32)13-15-28(33)20-6-5-9-23(18-20)31-29(34)21-7-4-8-22(30)17-21/h2-18H,1H3,(H,31,34)/b15-13+ |
| InChIKey | PZCHRFNIISVJGO-FYWRMAATSA-N |
| XLogP | 6.62 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|