C13H16N2O2S — CID 56813268
3-(1,4-thiazepan-4-ylmethyl)-1,3-benzoxazol-2-one (PubChem CID 56813268) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(1,4-thiazepan-4-ylmethyl)-1,3-benzoxazol-2-one.
| Compound Name | 3-(1,4-thiazepan-4-ylmethyl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 56813268 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(1,4-thiazepan-4-ylmethyl)-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CN1CCCSCC1 |
| InChI | InChI=1S/C13H16N2O2S/c16-13-15(10-14-6-3-8-18-9-7-14)11-4-1-2-5-12(11)17-13/h1-2,4-5H,3,6-10H2 |
| InChIKey | BIDOIQRDTQTWIH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |