C18H20N2O7 — CID 139088331
6-hydroxy-1,3-dimethyl-5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrimidine-2,4-dione (PubChem CID 139088331) has the molecular formula C18H20N2O7 and a molecular weight of 376.37 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethyl-5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-1,3-dimethyl-5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 139088331 |
| Molecular Formula | C18H20N2O7 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 6-hydroxy-1,3-dimethyl-5-[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]pyrimidine-2,4-dione |
| SMILES | COc1cc(/C=C/C(=O)c2c(O)n(C)c(=O)n(C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C18H20N2O7/c1-19-16(22)14(17(23)20(2)18(19)24)11(21)7-6-10-8-12(25-3)15(27-5)13(9-10)26-4/h6-9,22H,1-5H3/b7-6+ |
| InChIKey | SGWNMCDIIRVQBO-VOTSOKGWSA-N |
| XLogP | 0.71 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|