C22H23NO6 — CID 54041387
2,2-dimethyl-7-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one (PubChem CID 54041387) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is 2,2-dimethyl-7-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 2,2-dimethyl-7-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 54041387 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 2,2-dimethyl-7-[3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]-4H-1,4-benzoxazin-3-one |
| SMILES | COc1cc(C=CC(=O)c2ccc3c(c2)OC(C)(C)C(=O)N3)cc(OC)c1OC |
| InChI | InChI=1S/C22H23NO6/c1-22(2)21(25)23-15-8-7-14(12-17(15)29-22)16(24)9-6-13-10-18(26-3)20(28-5)19(11-13)27-4/h6-12H,1-5H3,(H,23,25) |
| InChIKey | LMOZCVYUGYCLJR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|