C26H27NO6 — CID 57399694
(E)-1-[4-amino-3-(3,4-dimethoxyphenyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 57399694) has the molecular formula C26H27NO6 and a molecular weight of 449.50 g/mol. Its IUPAC name is (E)-1-[4-amino-3-(3,4-dimethoxyphenyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-amino-3-(3,4-dimethoxyphenyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57399694 |
| Molecular Formula | C26H27NO6 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | (E)-1-[4-amino-3-(3,4-dimethoxyphenyl)phenyl]-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(-c2cc(C(=O)/C=C/c3cc(OC)c(OC)c(OC)c3)ccc2N)cc1OC |
| InChI | InChI=1S/C26H27NO6/c1-29-22-11-8-17(15-23(22)30-2)19-14-18(7-9-20(19)27)21(28)10-6-16-12-24(31-3)26(33-5)25(13-16)32-4/h6-15H,27H2,1-5H3/b10-6+ |
| InChIKey | RUARNOMTHBPSMP-UXBLZVDNSA-N |
| XLogP | 4.87 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|