C21H25NO5S — CID 71767196
O-[2-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N,N-dimethylcarbamothioate (PubChem CID 71767196) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is O-[2-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | O-[2-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 71767196 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | O-[2-methoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl] N,N-dimethylcarbamothioate |
| SMILES | COc1cccc(/C=C\c2cc(OC)c(OC)c(OC)c2)c1OC(=S)N(C)C |
| InChI | InChI=1S/C21H25NO5S/c1-22(2)21(28)27-19-15(8-7-9-16(19)23-3)11-10-14-12-17(24-4)20(26-6)18(13-14)25-5/h7-13H,1-6H3/b11-10- |
| InChIKey | XGJVJXSLPBFPFR-KHPPLWFESA-N |
| XLogP | 4.12 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|