C20H19NO3 — CID 10426212
6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]quinoline (PubChem CID 10426212) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]quinoline.
| Compound Name | 6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]quinoline |
|---|---|
| PubChem CID | 10426212 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]quinoline |
| SMILES | COc1cc(/C=C\c2ccc3ncccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19NO3/c1-22-18-12-15(13-19(23-2)20(18)24-3)7-6-14-8-9-17-16(11-14)5-4-10-21-17/h4-13H,1-3H3/b7-6- |
| InChIKey | PNNBXBNYOZPREH-SREVYHEPSA-N |
| XLogP | 4.43 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|