About quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone
quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 45139642) has the molecular formula C19H17NO4
and a molecular weight of 323.35 g/mol. Its IUPAC name is quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone.
Molecular Properties
| Compound Name | quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone |
| PubChem CID | 45139642 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccc3ncccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H17NO4/c1-22-16-10-14(11-17(23-2)19(16)24-3)18(21)13-6-7-15-12(9-13)5-4-8-20-15/h4-11H,1-3H3 |
| InChIKey | GSGXITQZCMSYKF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone?
The IUPAC name of quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone (CID 45139642) is quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone.
What is the SMILES notation for quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone?
The canonical SMILES for quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone is COc1cc(C(=O)c2ccc3ncccc3c2)cc(OC)c1OC.
What is the InChIKey of quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone?
The InChIKey is GSGXITQZCMSYKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO4/c1-22-16-10-14(11-17(23-2)19(16)24-3)18(21)13-6-7-15-12(9-13)5-4-8-20-15/h4-11H,1-3H3.
What are the key properties of quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone?
quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone has a molecular weight of 323.35 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-6-yl-(3,4,5-trimethoxyphenyl)methanone is sourced from PubChem (CID 45139642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).