C27H23F6NS — CID 129295391
1-butyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindole (PubChem CID 129295391) has the molecular formula C27H23F6NS and a molecular weight of 507.54 g/mol. Its IUPAC name is 1-butyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindole.
| Compound Name | 1-butyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindole |
|---|---|
| PubChem CID | 129295391 |
| Molecular Formula | C27H23F6NS |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 1-butyl-3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindole |
| SMILES | CCCCn1c(C)c(C2=C(c3c(C)sc4ccccc34)C(F)(F)C(F)(F)C2(F)F)c2ccccc21 |
| InChI | InChI=1S/C27H23F6NS/c1-4-5-14-34-15(2)21(17-10-6-8-12-19(17)34)23-24(26(30,31)27(32,33)25(23,28)29)22-16(3)35-20-13-9-7-11-18(20)22/h6-13H,4-5,14H2,1-3H3 |
| InChIKey | STVIZVAZSJTPFX-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|