C32H32F6N2OS — CID 90687353
5-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindol-1-yl]pentyl N-propylmethanimidate (PubChem CID 90687353) has the molecular formula C32H32F6N2OS and a molecular weight of 606.68 g/mol. Its IUPAC name is 5-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindol-1-yl]pentyl N-propylmethanimidate.
| Compound Name | 5-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindol-1-yl]pentyl N-propylmethanimidate |
|---|---|
| PubChem CID | 90687353 |
| Molecular Formula | C32H32F6N2OS |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 5-[3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-methylindol-1-yl]pentyl N-propylmethanimidate |
| SMILES | CCC/N=C/OCCCCCn1c(C)c(C2=C(c3c(C)sc4ccccc34)C(F)(F)C(F)(F)C2(F)F)c2ccccc21 |
| InChI | InChI=1S/C32H32F6N2OS/c1-4-16-39-19-41-18-11-5-10-17-40-20(2)26(22-12-6-8-14-24(22)40)28-29(31(35,36)32(37,38)30(28,33)34)27-21(3)42-25-15-9-7-13-23(25)27/h6-9,12-15,19H,4-5,10-11,16-18H2,1-3H3/b39-19+ |
| InChIKey | GUOKVSZFKHUZCR-NNRJCLOKSA-N |
| XLogP | 9.93 |
| TPSA | 26.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|