C33H34F6S2 — CID 101397460
3-[3,3,4,4,5,5-hexafluoro-2-(2-hexyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-hexyl-1-benzothiophene (PubChem CID 101397460) has the molecular formula C33H34F6S2 and a molecular weight of 608.76 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-hexyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-hexyl-1-benzothiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-hexyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-hexyl-1-benzothiophene |
|---|---|
| PubChem CID | 101397460 |
| Molecular Formula | C33H34F6S2 |
| Molecular Weight | 608.76 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-hexyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-2-hexyl-1-benzothiophene |
| SMILES | CCCCCCc1sc2ccccc2c1C1=C(c2c(CCCCCC)sc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C33H34F6S2/c1-3-5-7-9-19-25-27(21-15-11-13-17-23(21)40-25)29-30(32(36,37)33(38,39)31(29,34)35)28-22-16-12-14-18-24(22)41-26(28)20-10-8-6-4-2/h11-18H,3-10,19-20H2,1-2H3 |
| InChIKey | KGHRURCIDABMRQ-UHFFFAOYSA-N |
| XLogP | 12.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.76 |
| LogP ≤ 5 | 12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|