About 2-hexylthiochromen-4-one
2-hexylthiochromen-4-one (PubChem CID 102347360) has the molecular formula C15H18OS
and a molecular weight of 246.38 g/mol. Its IUPAC name is 2-hexylthiochromen-4-one.
Molecular Properties
| Compound Name | 2-hexylthiochromen-4-one |
| PubChem CID | 102347360 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 2-hexylthiochromen-4-one |
| SMILES | CCCCCCc1cc(=O)c2ccccc2s1 |
| InChI | InChI=1S/C15H18OS/c1-2-3-4-5-8-12-11-14(16)13-9-6-7-10-15(13)17-12/h6-7,9-11H,2-5,8H2,1H3 |
| InChIKey | YCKVPDILQOUQPN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hexylthiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexylthiochromen-4-one?
The IUPAC name of 2-hexylthiochromen-4-one (CID 102347360) is 2-hexylthiochromen-4-one.
What is the SMILES notation for 2-hexylthiochromen-4-one?
The canonical SMILES for 2-hexylthiochromen-4-one is CCCCCCc1cc(=O)c2ccccc2s1.
What is the InChIKey of 2-hexylthiochromen-4-one?
The InChIKey is YCKVPDILQOUQPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18OS/c1-2-3-4-5-8-12-11-14(16)13-9-6-7-10-15(13)17-12/h6-7,9-11H,2-5,8H2,1H3.
What are the key properties of 2-hexylthiochromen-4-one?
2-hexylthiochromen-4-one has a molecular weight of 246.38 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexylthiochromen-4-one is sourced from PubChem (CID 102347360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).