C37H18F6S2 — CID 102354489
3-[3,3,4,4,5,5-hexafluoro-2-[2-(2-phenylethynyl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-(2-phenylethynyl)-1-benzothiophene (PubChem CID 102354489) has the molecular formula C37H18F6S2 and a molecular weight of 640.67 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-[2-(2-phenylethynyl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-(2-phenylethynyl)-1-benzothiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-(2-phenylethynyl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-(2-phenylethynyl)-1-benzothiophene |
|---|---|
| PubChem CID | 102354489 |
| Molecular Formula | C37H18F6S2 |
| Molecular Weight | 640.67 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-[2-(2-phenylethynyl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-(2-phenylethynyl)-1-benzothiophene |
| SMILES | FC1(F)C(c2c(C#Cc3ccccc3)sc3ccccc23)=C(c2c(C#Cc3ccccc3)sc3ccccc23)C(F)(F)C1(F)F |
| InChI | InChI=1S/C37H18F6S2/c38-35(39)33(31-25-15-7-9-17-27(25)44-29(31)21-19-23-11-3-1-4-12-23)34(36(40,41)37(35,42)43)32-26-16-8-10-18-28(26)45-30(32)22-20-24-13-5-2-6-14-24/h1-18H |
| InChIKey | DEGDWZXDNYLIEQ-UHFFFAOYSA-N |
| XLogP | 10.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.67 |
| LogP ≤ 5 | 10.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|