C21H14BrF6NS — CID 102221499
2-bromo-6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-3,5-dimethylpyridine (PubChem CID 102221499) has the molecular formula C21H14BrF6NS and a molecular weight of 506.31 g/mol. Its IUPAC name is 2-bromo-6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-3,5-dimethylpyridine.
| Compound Name | 2-bromo-6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 102221499 |
| Molecular Formula | C21H14BrF6NS |
| Molecular Weight | 506.31 g/mol |
| Exact Mass | 504.99 |
| IUPAC Name | 2-bromo-6-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-3,5-dimethylpyridine |
| SMILES | Cc1cc(C)c(C2=C(c3c(C)sc4ccccc34)C(F)(F)C(F)(F)C2(F)F)nc1Br |
| InChI | InChI=1S/C21H14BrF6NS/c1-9-8-10(2)18(22)29-17(9)16-15(19(23,24)21(27,28)20(16,25)26)14-11(3)30-13-7-5-4-6-12(13)14/h4-8H,1-3H3 |
| InChIKey | YVYKUIPQYQASSI-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.31 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|