C41H24F6N2S4 — CID 102342594
4-[3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-2-phenyl-1,3-thiazole (PubChem CID 102342594) has the molecular formula C41H24F6N2S4 and a molecular weight of 786.91 g/mol. Its IUPAC name is 4-[3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-2-phenyl-1,3-thiazole.
| Compound Name | 4-[3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-2-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 102342594 |
| Molecular Formula | C41H24F6N2S4 |
| Molecular Weight | 786.91 g/mol |
| Exact Mass | 786.07 |
| IUPAC Name | 4-[3-[3,3,4,4,5,5-hexafluoro-2-[2-methyl-6-(2-phenyl-1,3-thiazol-4-yl)-1-benzothiophen-3-yl]cyclopenten-1-yl]-2-methyl-1-benzothiophen-6-yl]-2-phenyl-1,3-thiazole |
| SMILES | Cc1sc2cc(-c3csc(-c4ccccc4)n3)ccc2c1C1=C(c2c(C)sc3cc(-c4csc(-c5ccccc5)n4)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C41H24F6N2S4/c1-21-33(27-15-13-25(17-31(27)52-21)29-19-50-37(48-29)23-9-5-3-6-10-23)35-36(40(44,45)41(46,47)39(35,42)43)34-22(2)53-32-18-26(14-16-28(32)34)30-20-51-38(49-30)24-11-7-4-8-12-24/h3-20H,1-2H3 |
| InChIKey | TZAQBSOOPMBGKM-UHFFFAOYSA-N |
| XLogP | 14.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.91 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|