C24H16F6S — CID 101389196
3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-3H-inden-1-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene (PubChem CID 101389196) has the molecular formula C24H16F6S and a molecular weight of 450.45 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-3H-inden-1-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-3H-inden-1-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 101389196 |
| Molecular Formula | C24H16F6S |
| Molecular Weight | 450.45 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(2-methyl-3H-inden-1-yl)cyclopenten-1-yl]-2-methyl-1-benzothiophene |
| SMILES | CC1=C(C2=C(c3c(C)sc4ccccc34)C(F)(F)C(F)(F)C2(F)F)c2ccccc2C1 |
| InChI | InChI=1S/C24H16F6S/c1-12-11-14-7-3-4-8-15(14)18(12)20-21(23(27,28)24(29,30)22(20,25)26)19-13(2)31-17-10-6-5-9-16(17)19/h3-10H,11H2,1-2H3 |
| InChIKey | OBCWMMXSRPEPSH-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.45 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|