C26H20O2S2 — CID 11144430
2,3-dimethyl-5,6-bis(2-methyl-1-benzothiophen-3-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 11144430) has the molecular formula C26H20O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2,3-dimethyl-5,6-bis(2-methyl-1-benzothiophen-3-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2,3-dimethyl-5,6-bis(2-methyl-1-benzothiophen-3-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 11144430 |
| Molecular Formula | C26H20O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2,3-dimethyl-5,6-bis(2-methyl-1-benzothiophen-3-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(c2c(C)sc3ccccc23)=C(c2c(C)sc3ccccc23)C1=O |
| InChI | InChI=1S/C26H20O2S2/c1-13-14(2)26(28)24(22-16(4)30-20-12-8-6-10-18(20)22)23(25(13)27)21-15(3)29-19-11-7-5-9-17(19)21/h5-12H,1-4H3 |
| InChIKey | OXPJOUOAQICOIY-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|