C18H12OS2 — CID 16750743
2-methyl-3-phenylthieno[3,2-c]thiochromen-4-one (PubChem CID 16750743) has the molecular formula C18H12OS2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-methyl-3-phenylthieno[3,2-c]thiochromen-4-one.
| Compound Name | 2-methyl-3-phenylthieno[3,2-c]thiochromen-4-one |
|---|---|
| PubChem CID | 16750743 |
| Molecular Formula | C18H12OS2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 2-methyl-3-phenylthieno[3,2-c]thiochromen-4-one |
| SMILES | Cc1sc2c(c1-c1ccccc1)c(=O)sc1ccccc12 |
| InChI | InChI=1S/C18H12OS2/c1-11-15(12-7-3-2-4-8-12)16-17(20-11)13-9-5-6-10-14(13)21-18(16)19/h2-10H,1H3 |
| InChIKey | OAMBQJHSYMPNSB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |