C23H17BrOS2 — CID 71484784
5-bromo-2,3-bis(2-methyl-1-benzothiophen-3-yl)cyclopent-2-en-1-one (PubChem CID 71484784) has the molecular formula C23H17BrOS2 and a molecular weight of 453.43 g/mol. Its IUPAC name is 5-bromo-2,3-bis(2-methyl-1-benzothiophen-3-yl)cyclopent-2-en-1-one.
| Compound Name | 5-bromo-2,3-bis(2-methyl-1-benzothiophen-3-yl)cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 71484784 |
| Molecular Formula | C23H17BrOS2 |
| Molecular Weight | 453.43 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 5-bromo-2,3-bis(2-methyl-1-benzothiophen-3-yl)cyclopent-2-en-1-one |
| SMILES | Cc1sc2ccccc2c1C1=C(c2c(C)sc3ccccc23)C(=O)C(Br)C1 |
| InChI | InChI=1S/C23H17BrOS2/c1-12-20(14-7-3-5-9-18(14)26-12)16-11-17(24)23(25)22(16)21-13(2)27-19-10-6-4-8-15(19)21/h3-10,17H,11H2,1-2H3 |
| InChIKey | WRRCPXUBNIPBAS-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.43 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|