C16H10OS — CID 141177162
15-methyl-14-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one (PubChem CID 141177162) has the molecular formula C16H10OS and a molecular weight of 250.32 g/mol. Its IUPAC name is 15-methyl-14-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one.
| Compound Name | 15-methyl-14-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
|---|---|
| PubChem CID | 141177162 |
| Molecular Formula | C16H10OS |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 15-methyl-14-thiatetracyclo[7.6.1.02,7.013,16]hexadeca-1(15),2,4,6,9(16),10,12-heptaen-8-one |
| SMILES | Cc1sc2cccc3c2c1-c1ccccc1C3=O |
| InChI | InChI=1S/C16H10OS/c1-9-14-10-5-2-3-6-11(10)16(17)12-7-4-8-13(18-9)15(12)14/h2-8H,1H3 |
| InChIKey | ADPZSOYTDODSJD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |