C23H12F6I2S2 — CID 71652754
3-[3,3,4,4,5,5-hexafluoro-2-(6-iodo-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-6-iodo-2-methyl-1-benzothiophene (PubChem CID 71652754) has the molecular formula C23H12F6I2S2 and a molecular weight of 720.28 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5-hexafluoro-2-(6-iodo-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-6-iodo-2-methyl-1-benzothiophene.
| Compound Name | 3-[3,3,4,4,5,5-hexafluoro-2-(6-iodo-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-6-iodo-2-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 71652754 |
| Molecular Formula | C23H12F6I2S2 |
| Molecular Weight | 720.28 g/mol |
| Exact Mass | 719.84 |
| IUPAC Name | 3-[3,3,4,4,5,5-hexafluoro-2-(6-iodo-2-methyl-1-benzothiophen-3-yl)cyclopenten-1-yl]-6-iodo-2-methyl-1-benzothiophene |
| SMILES | Cc1sc2cc(I)ccc2c1C1=C(c2c(C)sc3cc(I)ccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C23H12F6I2S2/c1-9-17(13-5-3-11(30)7-15(13)32-9)19-20(22(26,27)23(28,29)21(19,24)25)18-10(2)33-16-8-12(31)4-6-14(16)18/h3-8H,1-2H3 |
| InChIKey | GVQVJSITSBTMHV-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.28 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|