C14H6F7IS — CID 139643265
3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-iodo-2-methyl-1-benzothiophene (PubChem CID 139643265) has the molecular formula C14H6F7IS and a molecular weight of 466.16 g/mol. Its IUPAC name is 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-iodo-2-methyl-1-benzothiophene.
| Compound Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-iodo-2-methyl-1-benzothiophene |
|---|---|
| PubChem CID | 139643265 |
| Molecular Formula | C14H6F7IS |
| Molecular Weight | 466.16 g/mol |
| Exact Mass | 465.91 |
| IUPAC Name | 3-(2,3,3,4,4,5,5-heptafluorocyclopenten-1-yl)-6-iodo-2-methyl-1-benzothiophene |
| SMILES | Cc1sc2cc(I)ccc2c1C1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H6F7IS/c1-5-9(7-3-2-6(22)4-8(7)23-5)10-11(15)13(18,19)14(20,21)12(10,16)17/h2-4H,1H3 |
| InChIKey | HKFLRDUCBWUCRI-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.16 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|