C27H26F6S4 — CID 101467302
3-[2-[5-(1,3-dithiolan-2-yl)-2-pentylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-ethyl-1-benzothiophene (PubChem CID 101467302) has the molecular formula C27H26F6S4 and a molecular weight of 592.76 g/mol. Its IUPAC name is 3-[2-[5-(1,3-dithiolan-2-yl)-2-pentylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-ethyl-1-benzothiophene.
| Compound Name | 3-[2-[5-(1,3-dithiolan-2-yl)-2-pentylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-ethyl-1-benzothiophene |
|---|---|
| PubChem CID | 101467302 |
| Molecular Formula | C27H26F6S4 |
| Molecular Weight | 592.76 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | 3-[2-[5-(1,3-dithiolan-2-yl)-2-pentylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-2-ethyl-1-benzothiophene |
| SMILES | CCCCCc1sc(C2SCCS2)cc1C1=C(c2c(CC)sc3ccccc23)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C27H26F6S4/c1-3-5-6-10-19-16(14-20(37-19)24-34-12-13-35-24)22-23(26(30,31)27(32,33)25(22,28)29)21-15-9-7-8-11-18(15)36-17(21)4-2/h7-9,11,14,24H,3-6,10,12-13H2,1-2H3 |
| InChIKey | FEPFGSXXNKSTQI-UHFFFAOYSA-N |
| XLogP | 10.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.76 |
| LogP ≤ 5 | 10.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|