C19H28OS — CID 175290720
3-methoxy-2,4-dipentyl-1-benzothiophene (PubChem CID 175290720) has the molecular formula C19H28OS and a molecular weight of 304.50 g/mol. Its IUPAC name is 3-methoxy-2,4-dipentyl-1-benzothiophene.
| Compound Name | 3-methoxy-2,4-dipentyl-1-benzothiophene |
|---|---|
| PubChem CID | 175290720 |
| Molecular Formula | C19H28OS |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 3-methoxy-2,4-dipentyl-1-benzothiophene |
| SMILES | CCCCCc1sc2cccc(CCCCC)c2c1OC |
| InChI | InChI=1S/C19H28OS/c1-4-6-8-11-15-12-10-14-16-18(15)19(20-3)17(21-16)13-9-7-5-2/h10,12,14H,4-9,11,13H2,1-3H3 |
| InChIKey | DXNROYDVHZTWGH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|