C12H15NO2S2 — CID 18331900
2-butyl-1-benzothiophene-3-sulfonamide (PubChem CID 18331900) has the molecular formula C12H15NO2S2 and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-butyl-1-benzothiophene-3-sulfonamide.
| Compound Name | 2-butyl-1-benzothiophene-3-sulfonamide |
|---|---|
| PubChem CID | 18331900 |
| Molecular Formula | C12H15NO2S2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 2-butyl-1-benzothiophene-3-sulfonamide |
| SMILES | CCCCc1sc2ccccc2c1S(N)(=O)=O |
| InChI | InChI=1S/C12H15NO2S2/c1-2-3-7-11-12(17(13,14)15)9-6-4-5-8-10(9)16-11/h4-6,8H,2-3,7H2,1H3,(H2,13,14,15) |
| InChIKey | FWEYUKWXJZJXDG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |